C41H60O19 — CID 162925517
[4,5-diacetyloxy-6-(2-hydroxy-2,6-dimethyl-10-methylidenedodeca-6,11-dien-3-yl)oxy-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 162925517) has the molecular formula C41H60O19 and a molecular weight of 856.91 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-(2-hydroxy-2,6-dimethyl-10-methylidenedodeca-6,11-dien-3-yl)oxy-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [4,5-diacetyloxy-6-(2-hydroxy-2,6-dimethyl-10-methylidenedodeca-6,11-dien-3-yl)oxy-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162925517 |
| Molecular Formula | C41H60O19 |
| Molecular Weight | 856.91 g/mol |
| Exact Mass | 856.37 |
| IUPAC Name | [4,5-diacetyloxy-6-(2-hydroxy-2,6-dimethyl-10-methylidenedodeca-6,11-dien-3-yl)oxy-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | C=CC(=C)CCC=C(C)CCC(OC1OC(COC(C)=O)C(OC2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)C(OC(C)=O)C1OC(C)=O)C(C)(C)O |
| InChI | InChI=1S/C41H60O19/c1-13-21(2)15-14-16-22(3)17-18-32(41(11,12)49)59-39-37(55-28(9)47)36(54-27(8)46)34(31(57-39)20-51-24(5)43)60-40-38(56-29(10)48)35(53-26(7)45)33(52-25(6)44)30(58-40)19-50-23(4)42/h13,16,30-40,49H,1-2,14-15,17-20H2,3-12H3 |
| InChIKey | KYKGEPUYNCVSID-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 241.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|