C31H46O13 — CID 162866311
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(3S,5S,6E,10Z)-12-acetyloxy-3-hydroxy-3,7,11-trimethyldodeca-1,6,10-trien-5-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 162866311) has the molecular formula C31H46O13 and a molecular weight of 626.70 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(3S,5S,6E,10Z)-12-acetyloxy-3-hydroxy-3,7,11-trimethyldodeca-1,6,10-trien-5-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(3S,5S,6E,10Z)-12-acetyloxy-3-hydroxy-3,7,11-trimethyldodeca-1,6,10-trien-5-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162866311 |
| Molecular Formula | C31H46O13 |
| Molecular Weight | 626.70 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(3S,5S,6E,10Z)-12-acetyloxy-3-hydroxy-3,7,11-trimethyldodeca-1,6,10-trien-5-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | C=C[C@@](C)(O)C[C@@H](/C=C(\C)CC/C=C(/C)COC(C)=O)O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H46O13/c1-10-31(9,37)15-25(14-18(2)12-11-13-19(3)16-38-20(4)32)43-30-29(42-24(8)36)28(41-23(7)35)27(40-22(6)34)26(44-30)17-39-21(5)33/h10,13-14,25-30,37H,1,11-12,15-17H2,2-9H3/b18-14+,19-13-/t25-,26-,27-,28+,29-,30-,31-/m1/s1 |
| InChIKey | MBSNUDWGRQUHLH-LFKUIPEYSA-N |
| XLogP | 3.02 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.70 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|