C26H38O5 — CID 162926472
[(1E,3R,3aS,5S,7R,7aR)-1-ethylidene-3-[(2R)-2-methylbutanoyl]oxy-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydroinden-5-yl] (E)-3-methylpent-2-enoate (PubChem CID 162926472) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is [(1E,3R,3aS,5S,7R,7aR)-1-ethylidene-3-[(2R)-2-methylbutanoyl]oxy-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydroinden-5-yl] (E)-3-methylpent-2-enoate.
| Compound Name | [(1E,3R,3aS,5S,7R,7aR)-1-ethylidene-3-[(2R)-2-methylbutanoyl]oxy-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydroinden-5-yl] (E)-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 162926472 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | [(1E,3R,3aS,5S,7R,7aR)-1-ethylidene-3-[(2R)-2-methylbutanoyl]oxy-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydroinden-5-yl] (E)-3-methylpent-2-enoate |
| SMILES | C=C1[C@@H]2[C@H](/C(=C\C)C(=O)[C@@H]2OC(=O)[C@H](C)CC)[C@@H](C(C)C)C[C@@H]1OC(=O)/C=C(\C)CC |
| InChI | InChI=1S/C26H38O5/c1-9-15(6)12-21(27)30-20-13-19(14(4)5)23-18(11-3)24(28)25(22(23)17(20)8)31-26(29)16(7)10-2/h11-12,14,16,19-20,22-23,25H,8-10,13H2,1-7H3/b15-12+,18-11+/t16-,19-,20+,22-,23-,25-/m1/s1 |
| InChIKey | XTQQLVJPORCMAK-AYLLDHPPSA-N |
| XLogP | 5.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|