C28H42O8 — CID 162868460
[1-(1-acetyloxyethyl)-6-(2-methylbutanoyloxy)-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] 4-hydroxy-3-methylpent-2-enoate (PubChem CID 162868460) has the molecular formula C28H42O8 and a molecular weight of 506.64 g/mol. Its IUPAC name is [1-(1-acetyloxyethyl)-6-(2-methylbutanoyloxy)-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] 4-hydroxy-3-methylpent-2-enoate.
| Compound Name | [1-(1-acetyloxyethyl)-6-(2-methylbutanoyloxy)-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] 4-hydroxy-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 162868460 |
| Molecular Formula | C28H42O8 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | [1-(1-acetyloxyethyl)-6-(2-methylbutanoyloxy)-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] 4-hydroxy-3-methylpent-2-enoate |
| SMILES | C=C1C2CC(=O)C(C(C)OC(C)=O)C2C(C(C)C)C(OC(=O)C(C)CC)C1OC(=O)C=C(C)C(C)O |
| InChI | InChI=1S/C28H42O8/c1-10-14(4)28(33)36-27-23(13(2)3)25-20(12-21(31)24(25)18(8)34-19(9)30)16(6)26(27)35-22(32)11-15(5)17(7)29/h11,13-14,17-18,20,23-27,29H,6,10,12H2,1-5,7-9H3 |
| InChIKey | DZRLYFVZPPHCBT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|