C31H44O10 — CID 162929867
[1-(1-acetyloxyethyl)-4-methylidene-7-(2-methyloxiran-2-yl)-6-(3-methylpentanoyloxy)-2-oxo-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] 4-acetyloxy-3-methylpent-2-enoate (PubChem CID 162929867) has the molecular formula C31H44O10 and a molecular weight of 576.68 g/mol. Its IUPAC name is [1-(1-acetyloxyethyl)-4-methylidene-7-(2-methyloxiran-2-yl)-6-(3-methylpentanoyloxy)-2-oxo-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] 4-acetyloxy-3-methylpent-2-enoate.
| Compound Name | [1-(1-acetyloxyethyl)-4-methylidene-7-(2-methyloxiran-2-yl)-6-(3-methylpentanoyloxy)-2-oxo-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] 4-acetyloxy-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 162929867 |
| Molecular Formula | C31H44O10 |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | [1-(1-acetyloxyethyl)-4-methylidene-7-(2-methyloxiran-2-yl)-6-(3-methylpentanoyloxy)-2-oxo-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] 4-acetyloxy-3-methylpent-2-enoate |
| SMILES | C=C1C2CC(=O)C(C(C)OC(C)=O)C2C(C2(C)CO2)C(OC(=O)CC(C)CC)C1OC(=O)C=C(C)C(C)OC(C)=O |
| InChI | InChI=1S/C31H44O10/c1-10-15(2)11-24(35)41-30-28(31(9)14-37-31)27-22(13-23(34)26(27)19(6)39-21(8)33)17(4)29(30)40-25(36)12-16(3)18(5)38-20(7)32/h12,15,18-19,22,26-30H,4,10-11,13-14H2,1-3,5-9H3 |
| InChIKey | VRHVTVGJPOIIAJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 134.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|