C31H44O8 — CID 162936412
[1-ethylidene-3,6-bis(2-methylbutanoyloxy)-4-methylidene-7-(2-methyloxiran-2-yl)-2-oxo-3,3a,5,6,7,7a-hexahydroinden-5-yl] 3-methylpent-2-enoate (PubChem CID 162936412) has the molecular formula C31H44O8 and a molecular weight of 544.69 g/mol. Its IUPAC name is [1-ethylidene-3,6-bis(2-methylbutanoyloxy)-4-methylidene-7-(2-methyloxiran-2-yl)-2-oxo-3,3a,5,6,7,7a-hexahydroinden-5-yl] 3-methylpent-2-enoate.
| Compound Name | [1-ethylidene-3,6-bis(2-methylbutanoyloxy)-4-methylidene-7-(2-methyloxiran-2-yl)-2-oxo-3,3a,5,6,7,7a-hexahydroinden-5-yl] 3-methylpent-2-enoate |
|---|---|
| PubChem CID | 162936412 |
| Molecular Formula | C31H44O8 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | [1-ethylidene-3,6-bis(2-methylbutanoyloxy)-4-methylidene-7-(2-methyloxiran-2-yl)-2-oxo-3,3a,5,6,7,7a-hexahydroinden-5-yl] 3-methylpent-2-enoate |
| SMILES | C=C1C(OC(=O)C=C(C)CC)C(OC(=O)C(C)CC)C(C2(C)CO2)C2C(=CC)C(=O)C(OC(=O)C(C)CC)C12 |
| InChI | InChI=1S/C31H44O8/c1-10-16(5)14-21(32)37-26-19(8)22-23(20(13-4)25(33)27(22)38-29(34)17(6)11-2)24(31(9)15-36-31)28(26)39-30(35)18(7)12-3/h13-14,17-18,22-24,26-28H,8,10-12,15H2,1-7,9H3 |
| InChIKey | WAQPPOMZPIGXAQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 108.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|