C21H30O7 — CID 162927242
(4,10-dihydroxy-6,10-dimethyl-3-methylidene-2,5-dioxo-3a,4,6,7,8,9,11,11a-octahydrocyclodeca[b]furan-11-yl) 3-methylpent-2-enoate (PubChem CID 162927242) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is (4,10-dihydroxy-6,10-dimethyl-3-methylidene-2,5-dioxo-3a,4,6,7,8,9,11,11a-octahydrocyclodeca[b]furan-11-yl) 3-methylpent-2-enoate.
| Compound Name | (4,10-dihydroxy-6,10-dimethyl-3-methylidene-2,5-dioxo-3a,4,6,7,8,9,11,11a-octahydrocyclodeca[b]furan-11-yl) 3-methylpent-2-enoate |
|---|---|
| PubChem CID | 162927242 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (4,10-dihydroxy-6,10-dimethyl-3-methylidene-2,5-dioxo-3a,4,6,7,8,9,11,11a-octahydrocyclodeca[b]furan-11-yl) 3-methylpent-2-enoate |
| SMILES | C=C1C(=O)OC2C1C(O)C(=O)C(C)CCCC(C)(O)C2OC(=O)C=C(C)CC |
| InChI | InChI=1S/C21H30O7/c1-6-11(2)10-14(22)27-19-18-15(13(4)20(25)28-18)17(24)16(23)12(3)8-7-9-21(19,5)26/h10,12,15,17-19,24,26H,4,6-9H2,1-3,5H3 |
| InChIKey | JJRFUIJKQYVCSP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|