C20H28O5 — CID 162964685
[(3aR,4S,4aR,5S,8aS,9aR)-5-hydroxy-5,8a-dimethyl-3-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-4-yl] 3-methylbut-2-enoate (PubChem CID 162964685) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is [(3aR,4S,4aR,5S,8aS,9aR)-5-hydroxy-5,8a-dimethyl-3-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-4-yl] 3-methylbut-2-enoate.
| Compound Name | [(3aR,4S,4aR,5S,8aS,9aR)-5-hydroxy-5,8a-dimethyl-3-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-4-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 162964685 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(3aR,4S,4aR,5S,8aS,9aR)-5-hydroxy-5,8a-dimethyl-3-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-4-yl] 3-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@@H]2C[C@]3(C)CCC[C@](C)(O)[C@H]3[C@@H](OC(=O)C=C(C)C)[C@H]12 |
| InChI | InChI=1S/C20H28O5/c1-11(2)9-14(21)25-16-15-12(3)18(22)24-13(15)10-19(4)7-6-8-20(5,23)17(16)19/h9,13,15-17,23H,3,6-8,10H2,1-2,4-5H3/t13-,15-,16+,17+,19+,20+/m1/s1 |
| InChIKey | RVSGNFPJFWGFIY-ZWYXNYKGSA-N |
| XLogP | 2.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|