C30H48O6 — CID 162927598
(1S,3S,4S,6S,7S,8R,11S,12S,15R,16R)-15-[(2R,5R)-5-hydroperoxy-6-methylhept-6-en-2-yl]-4,6-dihydroxy-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylic acid (PubChem CID 162927598) has the molecular formula C30H48O6 and a molecular weight of 504.71 g/mol. Its IUPAC name is (1S,3S,4S,6S,7S,8R,11S,12S,15R,16R)-15-[(2R,5R)-5-hydroperoxy-6-methylhept-6-en-2-yl]-4,6-dihydroxy-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylic acid.
| Compound Name | (1S,3S,4S,6S,7S,8R,11S,12S,15R,16R)-15-[(2R,5R)-5-hydroperoxy-6-methylhept-6-en-2-yl]-4,6-dihydroxy-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylic acid |
|---|---|
| PubChem CID | 162927598 |
| Molecular Formula | C30H48O6 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | (1S,3S,4S,6S,7S,8R,11S,12S,15R,16R)-15-[(2R,5R)-5-hydroperoxy-6-methylhept-6-en-2-yl]-4,6-dihydroxy-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylic acid |
| SMILES | C=C(C)[C@@H](CC[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4[C@](C)(C(=O)O)[C@@H](O)C[C@H](O)[C@@]45C[C@@]35CC[C@]12C)OO |
| InChI | InChI=1S/C30H48O6/c1-17(2)20(36-35)8-7-18(3)19-11-12-27(5)21-9-10-22-28(6,25(33)34)23(31)15-24(32)30(22)16-29(21,30)14-13-26(19,27)4/h18-24,31-32,35H,1,7-16H2,2-6H3,(H,33,34)/t18-,19-,20-,21+,22+,23+,24+,26-,27+,28+,29+,30-/m1/s1 |
| InChIKey | DBWPILOLPUDSNJ-XJLZVQPFSA-N |
| XLogP | 5.67 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|