C30H48O4 — CID 85276874
4,6-dihydroxy-12,16-dimethyl-15-(6-methyl-5-methylideneheptan-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylic acid (PubChem CID 85276874) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is 4,6-dihydroxy-12,16-dimethyl-15-(6-methyl-5-methylideneheptan-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylic acid.
| Compound Name | 4,6-dihydroxy-12,16-dimethyl-15-(6-methyl-5-methylideneheptan-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylic acid |
|---|---|
| PubChem CID | 85276874 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | 4,6-dihydroxy-12,16-dimethyl-15-(6-methyl-5-methylideneheptan-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylic acid |
| SMILES | C=C(CCC(C)C1CCC2(C)C3CCC4C(C(=O)O)C(O)CC(O)C45CC35CCC12C)C(C)C |
| InChI | InChI=1S/C30H48O4/c1-17(2)18(3)7-8-19(4)20-11-12-28(6)23-10-9-21-25(26(33)34)22(31)15-24(32)30(21)16-29(23,30)14-13-27(20,28)5/h17,19-25,31-32H,3,7-16H2,1-2,4-6H3,(H,33,34) |
| InChIKey | YWHSVTOZVOOYJX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|