C31H54O — CID 5316248
(3S,9S,13R)-9-ethyl-4,13,14-trimethyl-17-(6-methyl-5-methylideneheptan-2-yl)-1,2,3,4,5,6,7,8,10,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 5316248) has the molecular formula C31H54O and a molecular weight of 442.77 g/mol. Its IUPAC name is (3S,9S,13R)-9-ethyl-4,13,14-trimethyl-17-(6-methyl-5-methylideneheptan-2-yl)-1,2,3,4,5,6,7,8,10,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,9S,13R)-9-ethyl-4,13,14-trimethyl-17-(6-methyl-5-methylideneheptan-2-yl)-1,2,3,4,5,6,7,8,10,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 5316248 |
| Molecular Formula | C31H54O |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 442.42 |
| IUPAC Name | (3S,9S,13R)-9-ethyl-4,13,14-trimethyl-17-(6-methyl-5-methylideneheptan-2-yl)-1,2,3,4,5,6,7,8,10,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C=C(CCC(C)C1CCC2(C)C3CCC4C(C)[C@@H](O)CCC4[C@]3(CC)CC[C@]12C)C(C)C |
| InChI | InChI=1S/C31H54O/c1-9-31-19-18-29(7)25(22(5)11-10-21(4)20(2)3)16-17-30(29,8)28(31)15-12-24-23(6)27(32)14-13-26(24)31/h20,22-28,32H,4,9-19H2,1-3,5-8H3/t22?,23?,24?,25?,26?,27-,28?,29+,30?,31-/m0/s1 |
| InChIKey | KOUHTEPPGZEODQ-VNWMOMKJSA-N |
| XLogP | 8.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|