C30H50O3 — CID 162817212
(1R,2S,5S,6S,9S,11R,14R,15R)-2,6,11,15-tetramethyl-14-[(2R)-6-methyl-5-methylideneheptan-2-yl]-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecane-5,9-diol (PubChem CID 162817212) has the molecular formula C30H50O3 and a molecular weight of 458.73 g/mol. Its IUPAC name is (1R,2S,5S,6S,9S,11R,14R,15R)-2,6,11,15-tetramethyl-14-[(2R)-6-methyl-5-methylideneheptan-2-yl]-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecane-5,9-diol.
| Compound Name | (1R,2S,5S,6S,9S,11R,14R,15R)-2,6,11,15-tetramethyl-14-[(2R)-6-methyl-5-methylideneheptan-2-yl]-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecane-5,9-diol |
|---|---|
| PubChem CID | 162817212 |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | (1R,2S,5S,6S,9S,11R,14R,15R)-2,6,11,15-tetramethyl-14-[(2R)-6-methyl-5-methylideneheptan-2-yl]-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecane-5,9-diol |
| SMILES | C=C(CC[C@@H](C)[C@H]1CC[C@@]2(C)C34O[C@]3(CC[C@]12C)[C@@]1(C)CC[C@H](O)[C@@H](C)C1CC4O)C(C)C |
| InChI | InChI=1S/C30H50O3/c1-18(2)19(3)9-10-20(4)22-11-14-28(8)26(22,6)15-16-29-27(7)13-12-24(31)21(5)23(27)17-25(32)30(28,29)33-29/h18,20-25,31-32H,3,9-17H2,1-2,4-8H3/t20-,21+,22-,23?,24+,25?,26-,27+,28-,29-,30?/m1/s1 |
| InChIKey | GFDDRRFCCFHKFF-WTFCDEIUSA-N |
| XLogP | 6.52 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|