C31H50O — CID 77179546
7,7,12,16-tetramethyl-15-(6-methyl-5-methylideneheptan-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-en-4-ol (PubChem CID 77179546) has the molecular formula C31H50O and a molecular weight of 438.74 g/mol. Its IUPAC name is 7,7,12,16-tetramethyl-15-(6-methyl-5-methylideneheptan-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-en-4-ol.
| Compound Name | 7,7,12,16-tetramethyl-15-(6-methyl-5-methylideneheptan-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-en-4-ol |
|---|---|
| PubChem CID | 77179546 |
| Molecular Formula | C31H50O |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 438.39 |
| IUPAC Name | 7,7,12,16-tetramethyl-15-(6-methyl-5-methylideneheptan-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-en-4-ol |
| SMILES | C=C(CCC(C)C1CCC2(C)C3CCC4C(C)(C)CC=C(O)C45CC35CCC12C)C(C)C |
| InChI | InChI=1S/C31H50O/c1-20(2)21(3)9-10-22(4)23-13-16-29(8)25-12-11-24-27(5,6)15-14-26(32)31(24)19-30(25,31)18-17-28(23,29)7/h14,20,22-25,32H,3,9-13,15-19H2,1-2,4-8H3 |
| InChIKey | JEMPSKTWEQAOIV-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|