C31H46O6 — CID 85277413
methyl 4,6-dihydroxy-7,12,16-trimethyl-15-(6-methyl-1,5-dioxohept-6-en-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate (PubChem CID 85277413) has the molecular formula C31H46O6 and a molecular weight of 514.70 g/mol. Its IUPAC name is methyl 4,6-dihydroxy-7,12,16-trimethyl-15-(6-methyl-1,5-dioxohept-6-en-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate.
| Compound Name | methyl 4,6-dihydroxy-7,12,16-trimethyl-15-(6-methyl-1,5-dioxohept-6-en-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate |
|---|---|
| PubChem CID | 85277413 |
| Molecular Formula | C31H46O6 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | methyl 4,6-dihydroxy-7,12,16-trimethyl-15-(6-methyl-1,5-dioxohept-6-en-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate |
| SMILES | C=C(C)C(=O)CCC(C=O)C1CCC2(C)C3CCC4C(C)(C(=O)OC)C(O)CC(O)C45CC35CCC12C |
| InChI | InChI=1S/C31H46O6/c1-18(2)21(33)8-7-19(16-32)20-11-12-28(4)22-9-10-23-29(5,26(36)37-6)24(34)15-25(35)31(23)17-30(22,31)14-13-27(20,28)3/h16,19-20,22-25,34-35H,1,7-15,17H2,2-6H3 |
| InChIKey | NGBSMGBGLBXIAG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|