C31H48O6 — CID 10768193
methyl (1S,3S,4S,6S,7S,8R,11S,12S,15R,16R)-4,6-dihydroxy-15-[(2S,6S)-2-hydroxy-6-prop-1-en-2-yloxan-3-yl]-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate (PubChem CID 10768193) has the molecular formula C31H48O6 and a molecular weight of 516.72 g/mol. Its IUPAC name is methyl (1S,3S,4S,6S,7S,8R,11S,12S,15R,16R)-4,6-dihydroxy-15-[(2S,6S)-2-hydroxy-6-prop-1-en-2-yloxan-3-yl]-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate.
| Compound Name | methyl (1S,3S,4S,6S,7S,8R,11S,12S,15R,16R)-4,6-dihydroxy-15-[(2S,6S)-2-hydroxy-6-prop-1-en-2-yloxan-3-yl]-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate |
|---|---|
| PubChem CID | 10768193 |
| Molecular Formula | C31H48O6 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | methyl (1S,3S,4S,6S,7S,8R,11S,12S,15R,16R)-4,6-dihydroxy-15-[(2S,6S)-2-hydroxy-6-prop-1-en-2-yloxan-3-yl]-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate |
| SMILES | C=C(C)[C@@H]1CCC([C@H]2CC[C@@]3(C)[C@@H]4CC[C@H]5[C@](C)(C(=O)OC)[C@@H](O)C[C@H](O)[C@@]56C[C@@]46CC[C@]23C)[C@@H](O)O1 |
| InChI | InChI=1S/C31H48O6/c1-17(2)20-8-7-18(25(34)37-20)19-11-12-28(4)21-9-10-22-29(5,26(35)36-6)23(32)15-24(33)31(22)16-30(21,31)14-13-27(19,28)3/h18-25,32-34H,1,7-16H2,2-6H3/t18?,19-,20+,21+,22+,23+,24+,25+,27-,28+,29+,30+,31-/m1/s1 |
| InChIKey | HILQVBZZVYEWGG-YAMIAEFOSA-N |
| XLogP | 4.60 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|