C18H30O7 — CID 162929841
(2S,3R,4S,5S,6R)-2-[[(1R,2S,6S,8R,9R)-9-hydroxy-1,2-dimethyl-6-tricyclo[4.4.0.02,8]decanyl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 162929841) has the molecular formula C18H30O7 and a molecular weight of 358.43 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[[(1R,2S,6S,8R,9R)-9-hydroxy-1,2-dimethyl-6-tricyclo[4.4.0.02,8]decanyl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[[(1R,2S,6S,8R,9R)-9-hydroxy-1,2-dimethyl-6-tricyclo[4.4.0.02,8]decanyl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162929841 |
| Molecular Formula | C18H30O7 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[[(1R,2S,6S,8R,9R)-9-hydroxy-1,2-dimethyl-6-tricyclo[4.4.0.02,8]decanyl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC12CCC[C@]3(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C[C@H]1[C@H](O)C[C@]23C |
| InChI | InChI=1S/C18H30O7/c1-16-4-3-5-18(6-9(16)10(20)7-17(16,18)2)25-15-14(23)13(22)12(21)11(8-19)24-15/h9-15,19-23H,3-8H2,1-2H3/t9-,10+,11+,12+,13-,14+,15-,16?,17+,18-/m0/s1 |
| InChIKey | PBJBQXPGXUFNNL-NJCUNGDESA-N |
| XLogP | -0.48 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |