C21H26O5 — CID 162930084
(4S,6S)-6-[(2R)-1-(3,4-dimethoxyphenyl)-1-oxopropan-2-yl]-4-methoxy-6-prop-2-enylcyclohex-2-en-1-one (PubChem CID 162930084) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (4S,6S)-6-[(2R)-1-(3,4-dimethoxyphenyl)-1-oxopropan-2-yl]-4-methoxy-6-prop-2-enylcyclohex-2-en-1-one.
| Compound Name | (4S,6S)-6-[(2R)-1-(3,4-dimethoxyphenyl)-1-oxopropan-2-yl]-4-methoxy-6-prop-2-enylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 162930084 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (4S,6S)-6-[(2R)-1-(3,4-dimethoxyphenyl)-1-oxopropan-2-yl]-4-methoxy-6-prop-2-enylcyclohex-2-en-1-one |
| SMILES | C=CC[C@@]1([C@@H](C)C(=O)c2ccc(OC)c(OC)c2)C[C@H](OC)C=CC1=O |
| InChI | InChI=1S/C21H26O5/c1-6-11-21(13-16(24-3)8-10-19(21)22)14(2)20(23)15-7-9-17(25-4)18(12-15)26-5/h6-10,12,14,16H,1,11,13H2,2-5H3/t14-,16+,21-/m0/s1 |
| InChIKey | QAEMYCJMFNDALC-PXARDIRTSA-N |
| XLogP | 3.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|