C27H40O9 — CID 162931088
[(3S,8S,9R,10R,11S,12S,13S,14R,17S)-12-acetyloxy-17-[(1R)-1-acetyloxyethyl]-8,11,14-trihydroxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 162931088) has the molecular formula C27H40O9 and a molecular weight of 508.61 g/mol. Its IUPAC name is [(3S,8S,9R,10R,11S,12S,13S,14R,17S)-12-acetyloxy-17-[(1R)-1-acetyloxyethyl]-8,11,14-trihydroxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9R,10R,11S,12S,13S,14R,17S)-12-acetyloxy-17-[(1R)-1-acetyloxyethyl]-8,11,14-trihydroxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 162931088 |
| Molecular Formula | C27H40O9 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | [(3S,8S,9R,10R,11S,12S,13S,14R,17S)-12-acetyloxy-17-[(1R)-1-acetyloxyethyl]-8,11,14-trihydroxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@]3(O)[C@H]2[C@H](O)[C@@H](OC(C)=O)[C@]2(C)[C@@H]([C@@H](C)OC(C)=O)CC[C@@]23O)C1 |
| InChI | InChI=1S/C27H40O9/c1-14(34-15(2)28)20-9-12-27(33)25(20,6)23(36-17(4)30)21(31)22-24(5)10-8-19(35-16(3)29)13-18(24)7-11-26(22,27)32/h7,14,19-23,31-33H,8-13H2,1-6H3/t14-,19+,20-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | YCBCUGZBCDSYID-SCYYUXRWSA-N |
| XLogP | 2.19 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|