C23H34O7 — CID 163014423
[(3S,8R,9R,10R,12S,13R,14S,17S)-3,8,14-trihydroxy-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-1-oxo-2,3,4,7,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-12-yl] acetate (PubChem CID 163014423) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is [(3S,8R,9R,10R,12S,13R,14S,17S)-3,8,14-trihydroxy-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-1-oxo-2,3,4,7,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-12-yl] acetate.
| Compound Name | [(3S,8R,9R,10R,12S,13R,14S,17S)-3,8,14-trihydroxy-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-1-oxo-2,3,4,7,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-12-yl] acetate |
|---|---|
| PubChem CID | 163014423 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | [(3S,8R,9R,10R,12S,13R,14S,17S)-3,8,14-trihydroxy-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-1-oxo-2,3,4,7,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H]2[C@@]3(C)C(=O)C[C@@H](O)CC3=CC[C@]2(O)[C@]2(O)CC[C@H]([C@H](C)O)[C@]12C |
| InChI | InChI=1S/C23H34O7/c1-12(24)16-6-8-23(29)21(16,4)19(30-13(2)25)11-17-20(3)14(5-7-22(17,23)28)9-15(26)10-18(20)27/h5,12,15-17,19,24,26,28-29H,6-11H2,1-4H3/t12-,15-,16+,17+,19-,20-,21+,22+,23-/m0/s1 |
| InChIKey | SANGGAGDAMAUPO-JRCVQSQTSA-N |
| XLogP | 1.26 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|