C19H23NO5 — CID 162932486
8-hydroxy-3,4-dimethoxy-17-methyl-17-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2(7),3,5-triene-11,12-dione (PubChem CID 162932486) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 8-hydroxy-3,4-dimethoxy-17-methyl-17-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2(7),3,5-triene-11,12-dione.
| Compound Name | 8-hydroxy-3,4-dimethoxy-17-methyl-17-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2(7),3,5-triene-11,12-dione |
|---|---|
| PubChem CID | 162932486 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 8-hydroxy-3,4-dimethoxy-17-methyl-17-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2(7),3,5-triene-11,12-dione |
| SMILES | COc1ccc2c(c1OC)C13CCC(=O)C(=O)C1(CC2O)N(C)CC3 |
| InChI | InChI=1S/C19H23NO5/c1-20-9-8-18-7-6-12(21)17(23)19(18,20)10-13(22)11-4-5-14(24-2)16(25-3)15(11)18/h4-5,13,22H,6-10H2,1-3H3 |
| InChIKey | VAARHLNSYYGKHW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|