C20H25NO7 — CID 131632942
(8R,11R,12S,13S)-11,13-dihydroxy-3,4,12-trimethoxy-17-methyl-18-oxa-17-azapentacyclo[8.4.3.18,11.01,10.02,7]octadeca-2(7),3,5-trien-16-one (PubChem CID 131632942) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is (8R,11R,12S,13S)-11,13-dihydroxy-3,4,12-trimethoxy-17-methyl-18-oxa-17-azapentacyclo[8.4.3.18,11.01,10.02,7]octadeca-2(7),3,5-trien-16-one.
| Compound Name | (8R,11R,12S,13S)-11,13-dihydroxy-3,4,12-trimethoxy-17-methyl-18-oxa-17-azapentacyclo[8.4.3.18,11.01,10.02,7]octadeca-2(7),3,5-trien-16-one |
|---|---|
| PubChem CID | 131632942 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (8R,11R,12S,13S)-11,13-dihydroxy-3,4,12-trimethoxy-17-methyl-18-oxa-17-azapentacyclo[8.4.3.18,11.01,10.02,7]octadeca-2(7),3,5-trien-16-one |
| SMILES | COc1ccc2c(c1OC)C13CC(=O)N(C)C14C[C@H]2O[C@@]4(O)[C@@H](OC)[C@@H](O)C3 |
| InChI | InChI=1S/C20H25NO7/c1-21-14(23)9-18-7-11(22)17(27-4)20(24)19(18,21)8-13(28-20)10-5-6-12(25-2)16(26-3)15(10)18/h5-6,11,13,17,22,24H,7-9H2,1-4H3/t11-,13+,17-,18?,19?,20-/m0/s1 |
| InChIKey | PLNNDLQOZUUKPW-RISQRLKASA-N |
| XLogP | 0.49 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |