C28H31NO7 — CID 73043951
(3,11-dihydroxy-4,12-dimethoxy-17-methyl-18-oxa-17-azapentacyclo[8.4.3.18,11.01,10.02,7]octadeca-2(7),3,5-trien-13-yl) 3-phenylprop-2-enoate (PubChem CID 73043951) has the molecular formula C28H31NO7 and a molecular weight of 493.56 g/mol. Its IUPAC name is (3,11-dihydroxy-4,12-dimethoxy-17-methyl-18-oxa-17-azapentacyclo[8.4.3.18,11.01,10.02,7]octadeca-2(7),3,5-trien-13-yl) 3-phenylprop-2-enoate.
| Compound Name | (3,11-dihydroxy-4,12-dimethoxy-17-methyl-18-oxa-17-azapentacyclo[8.4.3.18,11.01,10.02,7]octadeca-2(7),3,5-trien-13-yl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 73043951 |
| Molecular Formula | C28H31NO7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (3,11-dihydroxy-4,12-dimethoxy-17-methyl-18-oxa-17-azapentacyclo[8.4.3.18,11.01,10.02,7]octadeca-2(7),3,5-trien-13-yl) 3-phenylprop-2-enoate |
| SMILES | COc1ccc2c(c1O)C13CCN(C)C14CC2OC4(O)C(OC)C(OC(=O)C=Cc1ccccc1)C3 |
| InChI | InChI=1S/C28H31NO7/c1-29-14-13-26-15-21(35-22(30)12-9-17-7-5-4-6-8-17)25(34-3)28(32)27(26,29)16-20(36-28)18-10-11-19(33-2)24(31)23(18)26/h4-12,20-21,25,31-32H,13-16H2,1-3H3 |
| InChIKey | HIDHXGLBVLLDSU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|