About (1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate
(1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate (PubChem CID 75443536) has the molecular formula C15H17NO3
and a molecular weight of 259.31 g/mol. Its IUPAC name is (1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | (1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate |
| PubChem CID | 75443536 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate |
| SMILES | O=CN1CCC(OC(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C15H17NO3/c17-12-16-10-8-14(9-11-16)19-15(18)7-6-13-4-2-1-3-5-13/h1-7,12,14H,8-11H2/b7-6+ |
| InChIKey | QDHOUXGDQRNOBW-VOTSOKGWSA-N |
| XLogP | 1.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate?
The IUPAC name of (1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate (CID 75443536) is (1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate.
What is the SMILES notation for (1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate?
The canonical SMILES for (1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate is O=CN1CCC(OC(=O)/C=C/c2ccccc2)CC1.
What is the InChIKey of (1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate?
The InChIKey is QDHOUXGDQRNOBW-VOTSOKGWSA-N. The full InChI is InChI=1S/C15H17NO3/c17-12-16-10-8-14(9-11-16)19-15(18)7-6-13-4-2-1-3-5-13/h1-7,12,14H,8-11H2/b7-6+.
What are the key properties of (1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate?
(1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate has a molecular weight of 259.31 g/mol, XLogP of 1.86, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-formylpiperidin-4-yl) (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 75443536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).