C20H18N2O3S — CID 90606357
[1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] (E)-3-phenylprop-2-enoate (PubChem CID 90606357) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is [1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 90606357 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1cccc2sc(N3CC(OC(=O)/C=C/c4ccccc4)C3)nc12 |
| InChI | InChI=1S/C20H18N2O3S/c1-24-16-8-5-9-17-19(16)21-20(26-17)22-12-15(13-22)25-18(23)11-10-14-6-3-2-4-7-14/h2-11,15H,12-13H2,1H3/b11-10+ |
| InChIKey | RNBFCOKVMNZELL-ZHACJKMWSA-N |
| XLogP | 3.75 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|