C21H22N2O3S — CID 90606383
[1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] 2-phenylbutanoate (PubChem CID 90606383) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is [1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] 2-phenylbutanoate.
| Compound Name | [1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] 2-phenylbutanoate |
|---|---|
| PubChem CID | 90606383 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] 2-phenylbutanoate |
| SMILES | CCC(C(=O)OC1CN(c2nc3c(OC)cccc3s2)C1)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O3S/c1-3-16(14-8-5-4-6-9-14)20(24)26-15-12-23(13-15)21-22-19-17(25-2)10-7-11-18(19)27-21/h4-11,15-16H,3,12-13H2,1-2H3 |
| InChIKey | SNRVFPBOBHOAIV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |