C16H13N3O6S — CID 90606401
[1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] 5-nitrofuran-2-carboxylate (PubChem CID 90606401) has the molecular formula C16H13N3O6S and a molecular weight of 375.36 g/mol. Its IUPAC name is [1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] 5-nitrofuran-2-carboxylate.
| Compound Name | [1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 90606401 |
| Molecular Formula | C16H13N3O6S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | [1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] 5-nitrofuran-2-carboxylate |
| SMILES | COc1cccc2sc(N3CC(OC(=O)c4ccc([N+](=O)[O-])o4)C3)nc12 |
| InChI | InChI=1S/C16H13N3O6S/c1-23-10-3-2-4-12-14(10)17-16(26-12)18-7-9(8-18)24-15(20)11-5-6-13(25-11)19(21)22/h2-6,9H,7-8H2,1H3 |
| InChIKey | MFWUTKMCPQKSPN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 107.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|