C21H21FN2O3S2 — CID 90606475
[1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] 4-(4-fluorophenyl)sulfanylbutanoate (PubChem CID 90606475) has the molecular formula C21H21FN2O3S2 and a molecular weight of 432.54 g/mol. Its IUPAC name is [1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] 4-(4-fluorophenyl)sulfanylbutanoate.
| Compound Name | [1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] 4-(4-fluorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 90606475 |
| Molecular Formula | C21H21FN2O3S2 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | [1-(4-methoxy-1,3-benzothiazol-2-yl)azetidin-3-yl] 4-(4-fluorophenyl)sulfanylbutanoate |
| SMILES | COc1cccc2sc(N3CC(OC(=O)CCCSc4ccc(F)cc4)C3)nc12 |
| InChI | InChI=1S/C21H21FN2O3S2/c1-26-17-4-2-5-18-20(17)23-21(29-18)24-12-15(13-24)27-19(25)6-3-11-28-16-9-7-14(22)8-10-16/h2,4-5,7-10,15H,3,6,11-13H2,1H3 |
| InChIKey | FOXLFDIVYJCWCN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|