C21H25NO6 — CID 163045311
(1S,10R)-3,4,11,12-tetramethoxy-17-methyl-17-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-13,16-dione (PubChem CID 163045311) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is (1S,10R)-3,4,11,12-tetramethoxy-17-methyl-17-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-13,16-dione.
| Compound Name | (1S,10R)-3,4,11,12-tetramethoxy-17-methyl-17-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-13,16-dione |
|---|---|
| PubChem CID | 163045311 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (1S,10R)-3,4,11,12-tetramethoxy-17-methyl-17-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-13,16-dione |
| SMILES | COC1=C(OC)[C@@]23CCc4ccc(OC)c(OC)c4[C@]2(CC1=O)CC(=O)N3C |
| InChI | InChI=1S/C21H25NO6/c1-22-15(24)11-20-10-13(23)17(26-3)19(28-5)21(20,22)9-8-12-6-7-14(25-2)18(27-4)16(12)20/h6-7H,8-11H2,1-5H3/t20-,21-/m0/s1 |
| InChIKey | SHCZSYHJJAWASJ-SFTDATJTSA-N |
| XLogP | 1.97 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |