C22H29NO6 — CID 25215819
(1R,12S)-4,11,12-trimethoxy-3-(methoxymethoxy)-13-methyl-13-azatetracyclo[10.3.2.01,10.02,7]heptadeca-2(7),3,5,10-tetraen-17-one (PubChem CID 25215819) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is (1R,12S)-4,11,12-trimethoxy-3-(methoxymethoxy)-13-methyl-13-azatetracyclo[10.3.2.01,10.02,7]heptadeca-2(7),3,5,10-tetraen-17-one.
| Compound Name | (1R,12S)-4,11,12-trimethoxy-3-(methoxymethoxy)-13-methyl-13-azatetracyclo[10.3.2.01,10.02,7]heptadeca-2(7),3,5,10-tetraen-17-one |
|---|---|
| PubChem CID | 25215819 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (1R,12S)-4,11,12-trimethoxy-3-(methoxymethoxy)-13-methyl-13-azatetracyclo[10.3.2.01,10.02,7]heptadeca-2(7),3,5,10-tetraen-17-one |
| SMILES | COCOc1c(OC)ccc2c1[C@]13CCN(C)[C@@](OC)(C(=O)C1)C(OC)=C3CC2 |
| InChI | InChI=1S/C22H29NO6/c1-23-11-10-21-12-17(24)22(23,28-5)20(27-4)15(21)8-6-14-7-9-16(26-3)19(18(14)21)29-13-25-2/h7,9H,6,8,10-13H2,1-5H3/t21-,22-/m1/s1 |
| InChIKey | YGZZPFBHLAJOLS-FGZHOGPDSA-N |
| XLogP | 2.41 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|