C15H22O4 — CID 162932737
3a,9-dihydroxy-5a,9-dimethyl-3-methylidene-5,6,7,8,9a,9b-hexahydro-4H-benzo[g][1]benzofuran-2-one (PubChem CID 162932737) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3a,9-dihydroxy-5a,9-dimethyl-3-methylidene-5,6,7,8,9a,9b-hexahydro-4H-benzo[g][1]benzofuran-2-one.
| Compound Name | 3a,9-dihydroxy-5a,9-dimethyl-3-methylidene-5,6,7,8,9a,9b-hexahydro-4H-benzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 162932737 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 3a,9-dihydroxy-5a,9-dimethyl-3-methylidene-5,6,7,8,9a,9b-hexahydro-4H-benzo[g][1]benzofuran-2-one |
| SMILES | C=C1C(=O)OC2C3C(C)(O)CCCC3(C)CCC12O |
| InChI | InChI=1S/C15H22O4/c1-9-12(16)19-11-10-13(2,7-8-15(9,11)18)5-4-6-14(10,3)17/h10-11,17-18H,1,4-8H2,2-3H3 |
| InChIKey | NZLXVTHNPSCQMS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|