C20H32O5 — CID 163067502
(1R,3E,5S,8R,12R,13R)-5,8,12-trihydroxy-4,8,12-trimethyl-16-methylidene-14-oxabicyclo[11.3.1]heptadec-3-en-15-one (PubChem CID 163067502) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (1R,3E,5S,8R,12R,13R)-5,8,12-trihydroxy-4,8,12-trimethyl-16-methylidene-14-oxabicyclo[11.3.1]heptadec-3-en-15-one.
| Compound Name | (1R,3E,5S,8R,12R,13R)-5,8,12-trihydroxy-4,8,12-trimethyl-16-methylidene-14-oxabicyclo[11.3.1]heptadec-3-en-15-one |
|---|---|
| PubChem CID | 163067502 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (1R,3E,5S,8R,12R,13R)-5,8,12-trihydroxy-4,8,12-trimethyl-16-methylidene-14-oxabicyclo[11.3.1]heptadec-3-en-15-one |
| SMILES | C=C1C(=O)O[C@@H]2C[C@H]1C/C=C(\C)[C@@H](O)CC[C@](C)(O)CCC[C@@]2(C)O |
| InChI | InChI=1S/C20H32O5/c1-13-6-7-15-12-17(25-18(22)14(15)2)20(4,24)10-5-9-19(3,23)11-8-16(13)21/h6,15-17,21,23-24H,2,5,7-12H2,1,3-4H3/b13-6+/t15-,16+,17-,19-,20-/m1/s1 |
| InChIKey | VSACXHNBFLZWMF-GCJMKRFOSA-N |
| XLogP | 2.64 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|