C24H32O8 — CID 162932815
(10-acetyloxy-6,9-dihydroxy-1,1,4a-trimethyl-5,8-dioxospiro[3,4,6,9,10,10a-hexahydro-2H-phenanthrene-7,2'-cyclopropane]-1'-yl)methyl acetate (PubChem CID 162932815) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is (10-acetyloxy-6,9-dihydroxy-1,1,4a-trimethyl-5,8-dioxospiro[3,4,6,9,10,10a-hexahydro-2H-phenanthrene-7,2'-cyclopropane]-1'-yl)methyl acetate.
| Compound Name | (10-acetyloxy-6,9-dihydroxy-1,1,4a-trimethyl-5,8-dioxospiro[3,4,6,9,10,10a-hexahydro-2H-phenanthrene-7,2'-cyclopropane]-1'-yl)methyl acetate |
|---|---|
| PubChem CID | 162932815 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (10-acetyloxy-6,9-dihydroxy-1,1,4a-trimethyl-5,8-dioxospiro[3,4,6,9,10,10a-hexahydro-2H-phenanthrene-7,2'-cyclopropane]-1'-yl)methyl acetate |
| SMILES | CC(=O)OCC1CC12C(=O)C1=C(C(=O)C2O)C2(C)CCCC(C)(C)C2C(OC(C)=O)C1O |
| InChI | InChI=1S/C24H32O8/c1-11(25)31-10-13-9-24(13)20(29)14-15(17(28)21(24)30)23(5)8-6-7-22(3,4)19(23)18(16(14)27)32-12(2)26/h13,16,18-19,21,27,30H,6-10H2,1-5H3 |
| InChIKey | JIJUBRUNSJAMST-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |