C20H28O5 — CID 11416768
(2S,7S,9R,12R,13R,17R)-9,17-dihydroxy-2,6,6,13-tetramethyl-15-oxatetracyclo[8.7.0.02,7.012,17]heptadec-1(10)-ene-11,16-dione (PubChem CID 11416768) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (2S,7S,9R,12R,13R,17R)-9,17-dihydroxy-2,6,6,13-tetramethyl-15-oxatetracyclo[8.7.0.02,7.012,17]heptadec-1(10)-ene-11,16-dione.
| Compound Name | (2S,7S,9R,12R,13R,17R)-9,17-dihydroxy-2,6,6,13-tetramethyl-15-oxatetracyclo[8.7.0.02,7.012,17]heptadec-1(10)-ene-11,16-dione |
|---|---|
| PubChem CID | 11416768 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (2S,7S,9R,12R,13R,17R)-9,17-dihydroxy-2,6,6,13-tetramethyl-15-oxatetracyclo[8.7.0.02,7.012,17]heptadec-1(10)-ene-11,16-dione |
| SMILES | C[C@H]1COC(=O)[C@]2(O)C3=C(C(=O)[C@H]12)[C@H](O)C[C@H]1C(C)(C)CCC[C@]31C |
| InChI | InChI=1S/C20H28O5/c1-10-9-25-17(23)20(24)14(10)15(22)13-11(21)8-12-18(2,3)6-5-7-19(12,4)16(13)20/h10-12,14,21,24H,5-9H2,1-4H3/t10-,11+,12-,14-,19-,20+/m0/s1 |
| InChIKey | MQVLZPBBUQPAEZ-OFCLWNRWSA-N |
| XLogP | 2.00 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |