C42H57N5O8 — CID 162934393
3-benzyl-12-butan-2-yl-6,7,13,15-tetramethyl-9-[[4-(3-methylbut-2-enoxy)phenyl]methyl]-4-oxa-1,7,10,13,16-pentazabicyclo[16.3.0]henicosane-2,5,8,11,14,17-hexone (PubChem CID 162934393) has the molecular formula C42H57N5O8 and a molecular weight of 759.95 g/mol. Its IUPAC name is 3-benzyl-12-butan-2-yl-6,7,13,15-tetramethyl-9-[[4-(3-methylbut-2-enoxy)phenyl]methyl]-4-oxa-1,7,10,13,16-pentazabicyclo[16.3.0]henicosane-2,5,8,11,14,17-hexone.
| Compound Name | 3-benzyl-12-butan-2-yl-6,7,13,15-tetramethyl-9-[[4-(3-methylbut-2-enoxy)phenyl]methyl]-4-oxa-1,7,10,13,16-pentazabicyclo[16.3.0]henicosane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 162934393 |
| Molecular Formula | C42H57N5O8 |
| Molecular Weight | 759.95 g/mol |
| Exact Mass | 759.42 |
| IUPAC Name | 3-benzyl-12-butan-2-yl-6,7,13,15-tetramethyl-9-[[4-(3-methylbut-2-enoxy)phenyl]methyl]-4-oxa-1,7,10,13,16-pentazabicyclo[16.3.0]henicosane-2,5,8,11,14,17-hexone |
| SMILES | CCC(C)C1C(=O)NC(Cc2ccc(OCC=C(C)C)cc2)C(=O)N(C)C(C)C(=O)OC(Cc2ccccc2)C(=O)N2CCCC2C(=O)NC(C)C(=O)N1C |
| InChI | InChI=1S/C42H57N5O8/c1-9-27(4)36-38(49)44-33(24-31-17-19-32(20-18-31)54-23-21-26(2)3)40(51)45(7)29(6)42(53)55-35(25-30-14-11-10-12-15-30)41(52)47-22-13-16-34(47)37(48)43-28(5)39(50)46(36)8/h10-12,14-15,17-21,27-29,33-36H,9,13,16,22-25H2,1-8H3,(H,43,48)(H,44,49) |
| InChIKey | QETFLADPCPUPIM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 154.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.95 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|