C17H30O4 — CID 162934694
methyl (E,2R,4R)-6-[(2S,5S)-5-[(1S)-1-hydroxyethyl]-5-methyloxolan-2-yl]-2,4-dimethylhept-5-enoate (PubChem CID 162934694) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is methyl (E,2R,4R)-6-[(2S,5S)-5-[(1S)-1-hydroxyethyl]-5-methyloxolan-2-yl]-2,4-dimethylhept-5-enoate.
| Compound Name | methyl (E,2R,4R)-6-[(2S,5S)-5-[(1S)-1-hydroxyethyl]-5-methyloxolan-2-yl]-2,4-dimethylhept-5-enoate |
|---|---|
| PubChem CID | 162934694 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | methyl (E,2R,4R)-6-[(2S,5S)-5-[(1S)-1-hydroxyethyl]-5-methyloxolan-2-yl]-2,4-dimethylhept-5-enoate |
| SMILES | COC(=O)[C@H](C)C[C@@H](C)/C=C(\C)[C@@H]1CC[C@@](C)([C@H](C)O)O1 |
| InChI | InChI=1S/C17H30O4/c1-11(10-13(3)16(19)20-6)9-12(2)15-7-8-17(5,21-15)14(4)18/h9,11,13-15,18H,7-8,10H2,1-6H3/b12-9+/t11-,13+,14-,15-,17-/m0/s1 |
| InChIKey | DHAIJHWVYRZTHH-BTAHLJJCSA-N |
| XLogP | 3.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|