C24H41NO7 — CID 89177258
methyl (2R)-2-[[hydroxy-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]methyl]amino]-4-methylpentanoate (PubChem CID 89177258) has the molecular formula C24H41NO7 and a molecular weight of 455.59 g/mol. Its IUPAC name is methyl (2R)-2-[[hydroxy-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]methyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[[hydroxy-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]methyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 89177258 |
| Molecular Formula | C24H41NO7 |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | methyl (2R)-2-[[hydroxy-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]methyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(O)O[C@@H]1CC[C@]2(CO2)[C@@H]([C@@]2(C)O[C@@H]2CC=C(C)C)[C@@H]1OC |
| InChI | InChI=1S/C24H41NO7/c1-14(2)8-9-18-23(5,32-18)20-19(28-6)17(10-11-24(20)13-30-24)31-22(27)25-16(12-15(3)4)21(26)29-7/h8,15-20,22,25,27H,9-13H2,1-7H3/t16-,17-,18-,19-,20-,22?,23+,24+/m1/s1 |
| InChIKey | XTFPRDXBOZXLMA-GZTXJEBXSA-N |
| XLogP | 2.53 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|