C24H41NO6 — CID 24878592
methyl (2R)-2-[[(S)-hydroxy-[[(3R,4S,5S,6R)-5-methoxy-4-[(1S,2S)-1-methyl-2-(3-methylbut-2-enyl)cyclopropyl]-1-oxaspiro[2.5]octan-6-yl]oxy]methyl]amino]-3-methylbutanoate (PubChem CID 24878592) has the molecular formula C24H41NO6 and a molecular weight of 439.59 g/mol. Its IUPAC name is methyl (2R)-2-[[(S)-hydroxy-[[(3R,4S,5S,6R)-5-methoxy-4-[(1S,2S)-1-methyl-2-(3-methylbut-2-enyl)cyclopropyl]-1-oxaspiro[2.5]octan-6-yl]oxy]methyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2R)-2-[[(S)-hydroxy-[[(3R,4S,5S,6R)-5-methoxy-4-[(1S,2S)-1-methyl-2-(3-methylbut-2-enyl)cyclopropyl]-1-oxaspiro[2.5]octan-6-yl]oxy]methyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 24878592 |
| Molecular Formula | C24H41NO6 |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | methyl (2R)-2-[[(S)-hydroxy-[[(3R,4S,5S,6R)-5-methoxy-4-[(1S,2S)-1-methyl-2-(3-methylbut-2-enyl)cyclopropyl]-1-oxaspiro[2.5]octan-6-yl]oxy]methyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@H](N[C@@H](O)O[C@@H]1CC[C@]2(CO2)[C@@H]([C@@]2(C)C[C@@H]2CC=C(C)C)[C@@H]1OC)C(C)C |
| InChI | InChI=1S/C24H41NO6/c1-14(2)8-9-16-12-23(16,5)20-19(28-6)17(10-11-24(20)13-30-24)31-22(27)25-18(15(3)4)21(26)29-7/h8,15-20,22,25,27H,9-13H2,1-7H3/t16-,17+,18+,19+,20+,22-,23-,24-/m0/s1 |
| InChIKey | OMFYYEPJYIBGPT-QYYYHGSSSA-N |
| XLogP | 3.01 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|