C22H35NO5 — CID 174244899
[(4S,5S,6R)-5-methoxy-4-[(1R,2R)-1-methyl-2-(3-methylbut-2-enyl)cyclobutyl]-1-oxaspiro[2.5]octan-6-yl] 3-hydroxyazetidine-1-carboxylate (PubChem CID 174244899) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is [(4S,5S,6R)-5-methoxy-4-[(1R,2R)-1-methyl-2-(3-methylbut-2-enyl)cyclobutyl]-1-oxaspiro[2.5]octan-6-yl] 3-hydroxyazetidine-1-carboxylate.
| Compound Name | [(4S,5S,6R)-5-methoxy-4-[(1R,2R)-1-methyl-2-(3-methylbut-2-enyl)cyclobutyl]-1-oxaspiro[2.5]octan-6-yl] 3-hydroxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 174244899 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | [(4S,5S,6R)-5-methoxy-4-[(1R,2R)-1-methyl-2-(3-methylbut-2-enyl)cyclobutyl]-1-oxaspiro[2.5]octan-6-yl] 3-hydroxyazetidine-1-carboxylate |
| SMILES | CO[C@@H]1[C@H](OC(=O)N2CC(O)C2)CCC2(CO2)[C@H]1[C@]1(C)CC[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C22H35NO5/c1-14(2)5-6-15-7-9-21(15,3)19-18(26-4)17(8-10-22(19)13-27-22)28-20(25)23-11-16(24)12-23/h5,15-19,24H,6-13H2,1-4H3/t15-,17+,18+,19+,21+,22?/m0/s1 |
| InChIKey | NBFIPIZHCQITDZ-HARWTWIBSA-N |
| XLogP | 3.13 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|