C31H55N3O6 — CID 174244851
[(2R)-2-[[(3R)-5-methoxy-4-[(2R)-1-methyl-2-(3-methylbut-2-enyl)cyclobutyl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-(6-aminohexyl)carbamate (PubChem CID 174244851) has the molecular formula C31H55N3O6 and a molecular weight of 565.80 g/mol. Its IUPAC name is [(2R)-2-[[(3R)-5-methoxy-4-[(2R)-1-methyl-2-(3-methylbut-2-enyl)cyclobutyl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-(6-aminohexyl)carbamate.
| Compound Name | [(2R)-2-[[(3R)-5-methoxy-4-[(2R)-1-methyl-2-(3-methylbut-2-enyl)cyclobutyl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-(6-aminohexyl)carbamate |
|---|---|
| PubChem CID | 174244851 |
| Molecular Formula | C31H55N3O6 |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.41 |
| IUPAC Name | [(2R)-2-[[(3R)-5-methoxy-4-[(2R)-1-methyl-2-(3-methylbut-2-enyl)cyclobutyl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-(6-aminohexyl)carbamate |
| SMILES | COC1C(OC(=O)N[C@@H](COC(=O)NCCCCCCN)C(C)C)CC[C@]2(CO2)C1C1(C)CC[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C31H55N3O6/c1-21(2)11-12-23-13-15-30(23,5)27-26(37-6)25(14-16-31(27)20-39-31)40-29(36)34-24(22(3)4)19-38-28(35)33-18-10-8-7-9-17-32/h11,22-27H,7-10,12-20,32H2,1-6H3,(H,33,35)(H,34,36)/t23-,24-,25?,26?,27?,30?,31-/m0/s1 |
| InChIKey | SNPSYVJYRYKWAQ-QDMLETMSSA-N |
| XLogP | 5.32 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|