C29H53N3O7 — CID 146266272
[(2R)-2-[[5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-(6-aminohexyl)carbamate (PubChem CID 146266272) has the molecular formula C29H53N3O7 and a molecular weight of 555.76 g/mol. Its IUPAC name is [(2R)-2-[[5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-(6-aminohexyl)carbamate.
| Compound Name | [(2R)-2-[[5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-(6-aminohexyl)carbamate |
|---|---|
| PubChem CID | 146266272 |
| Molecular Formula | C29H53N3O7 |
| Molecular Weight | 555.76 g/mol |
| Exact Mass | 555.39 |
| IUPAC Name | [(2R)-2-[[5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-(6-aminohexyl)carbamate |
| SMILES | COC1C(OC(=O)N[C@@H](COC(=O)NCCCCCCN)C(C)C)CCC2(CO2)C1C(C)(C)OCC=C(C)C |
| InChI | InChI=1S/C29H53N3O7/c1-20(2)13-17-37-28(5,6)25-24(35-7)23(12-14-29(25)19-38-29)39-27(34)32-22(21(3)4)18-36-26(33)31-16-11-9-8-10-15-30/h13,21-25H,8-12,14-19,30H2,1-7H3,(H,31,33)(H,32,34)/t22-,23?,24?,25?,29?/m0/s1 |
| InChIKey | NWXMVEHOYRTJRI-NYEMYMPXSA-N |
| XLogP | 4.31 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|