C26H36O7 — CID 143815012
(2E,4E,6E,8E)-10-[[(3R,5S,6R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]-10-oxodeca-2,4,6,8-tetraenoic acid (PubChem CID 143815012) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is (2E,4E,6E,8E)-10-[[(3R,5S,6R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]-10-oxodeca-2,4,6,8-tetraenoic acid.
| Compound Name | (2E,4E,6E,8E)-10-[[(3R,5S,6R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]-10-oxodeca-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 143815012 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | (2E,4E,6E,8E)-10-[[(3R,5S,6R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]-10-oxodeca-2,4,6,8-tetraenoic acid |
| SMILES | CO[C@H]1C(C(C)(C)OCC=C(C)C)[C@]2(CC[C@H]1OC(=O)/C=C/C=C/C=C/C=C/C(=O)O)CO2 |
| InChI | InChI=1S/C26H36O7/c1-19(2)15-17-31-25(3,4)24-23(30-5)20(14-16-26(24)18-32-26)33-22(29)13-11-9-7-6-8-10-12-21(27)28/h6-13,15,20,23-24H,14,16-18H2,1-5H3,(H,27,28)/b8-6+,9-7+,12-10+,13-11+/t20-,23-,24?,26+/m1/s1 |
| InChIKey | HPDGTGBSJKNRCE-SGSLPPOPSA-N |
| XLogP | 4.16 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|