C28H42N2O7 — CID 137481964
tert-butyl N-[4-[[(3R,4R,5S,6R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]phenyl]carbamate (PubChem CID 137481964) has the molecular formula C28H42N2O7 and a molecular weight of 518.65 g/mol. Its IUPAC name is tert-butyl N-[4-[[(3R,4R,5S,6R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(3R,4R,5S,6R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 137481964 |
| Molecular Formula | C28H42N2O7 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | tert-butyl N-[4-[[(3R,4R,5S,6R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]phenyl]carbamate |
| SMILES | CO[C@H]1[C@H](C(C)(C)OCC=C(C)C)[C@]2(CC[C@H]1OC(=O)Nc1ccc(NC(=O)OC(C)(C)C)cc1)CO2 |
| InChI | InChI=1S/C28H42N2O7/c1-18(2)14-16-34-27(6,7)23-22(33-8)21(13-15-28(23)17-35-28)36-24(31)29-19-9-11-20(12-10-19)30-25(32)37-26(3,4)5/h9-12,14,21-23H,13,15-17H2,1-8H3,(H,29,31)(H,30,32)/t21-,22-,23-,28+/m1/s1 |
| InChIKey | VUMDKYPSQLTQQG-IZXSZHORSA-N |
| XLogP | 5.91 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|