C22H38N2O5 — CID 129234821
[(3R)-5-methoxy-4-[(1S)-1-(3-methylbut-2-enoxy)ethyl]-1-oxaspiro[2.5]octan-6-yl] N-(4-aminocyclohexyl)carbamate (PubChem CID 129234821) has the molecular formula C22H38N2O5 and a molecular weight of 410.56 g/mol. Its IUPAC name is [(3R)-5-methoxy-4-[(1S)-1-(3-methylbut-2-enoxy)ethyl]-1-oxaspiro[2.5]octan-6-yl] N-(4-aminocyclohexyl)carbamate.
| Compound Name | [(3R)-5-methoxy-4-[(1S)-1-(3-methylbut-2-enoxy)ethyl]-1-oxaspiro[2.5]octan-6-yl] N-(4-aminocyclohexyl)carbamate |
|---|---|
| PubChem CID | 129234821 |
| Molecular Formula | C22H38N2O5 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | [(3R)-5-methoxy-4-[(1S)-1-(3-methylbut-2-enoxy)ethyl]-1-oxaspiro[2.5]octan-6-yl] N-(4-aminocyclohexyl)carbamate |
| SMILES | COC1C(OC(=O)NC2CCC(N)CC2)CC[C@]2(CO2)C1C(C)OCC=C(C)C |
| InChI | InChI=1S/C22H38N2O5/c1-14(2)10-12-27-15(3)19-20(26-4)18(9-11-22(19)13-28-22)29-21(25)24-17-7-5-16(23)6-8-17/h10,15-20H,5-9,11-13,23H2,1-4H3,(H,24,25)/t15?,16?,17?,18?,19?,20?,22-/m0/s1 |
| InChIKey | BJHIVBDTGGMZSO-JHIOLDQKSA-N |
| XLogP | 2.92 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|