C22H39N3O6 — CID 146266200
[(3R)-4-[(2S,3R)-3-hydroxy-6-methylhept-5-en-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[3-[(2-aminoacetyl)amino]propyl]carbamate (PubChem CID 146266200) has the molecular formula C22H39N3O6 and a molecular weight of 441.57 g/mol. Its IUPAC name is [(3R)-4-[(2S,3R)-3-hydroxy-6-methylhept-5-en-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[3-[(2-aminoacetyl)amino]propyl]carbamate.
| Compound Name | [(3R)-4-[(2S,3R)-3-hydroxy-6-methylhept-5-en-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[3-[(2-aminoacetyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 146266200 |
| Molecular Formula | C22H39N3O6 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | [(3R)-4-[(2S,3R)-3-hydroxy-6-methylhept-5-en-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[3-[(2-aminoacetyl)amino]propyl]carbamate |
| SMILES | COC1C(OC(=O)NCCCNC(=O)CN)CC[C@]2(CO2)C1C(C)[C@H](O)CC=C(C)C |
| InChI | InChI=1S/C22H39N3O6/c1-14(2)6-7-16(26)15(3)19-20(29-4)17(8-9-22(19)13-30-22)31-21(28)25-11-5-10-24-18(27)12-23/h6,15-17,19-20,26H,5,7-13,23H2,1-4H3,(H,24,27)(H,25,28)/t15?,16-,17?,19?,20?,22+/m1/s1 |
| InChIKey | DUTJENFHOWLRET-VYOQCNJUSA-N |
| XLogP | 1.09 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|