C25H44FN3O7 — CID 130226499
[(3R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[6-[[2-(fluorooxyamino)acetyl]amino]hexyl]carbamate (PubChem CID 130226499) has the molecular formula C25H44FN3O7 and a molecular weight of 517.64 g/mol. Its IUPAC name is [(3R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[6-[[2-(fluorooxyamino)acetyl]amino]hexyl]carbamate.
| Compound Name | [(3R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[6-[[2-(fluorooxyamino)acetyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 130226499 |
| Molecular Formula | C25H44FN3O7 |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | [(3R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[6-[[2-(fluorooxyamino)acetyl]amino]hexyl]carbamate |
| SMILES | COC1C(OC(=O)NCCCCCCNC(=O)CNOF)CC[C@]2(CO2)C1C(C)(C)OCC=C(C)C |
| InChI | InChI=1S/C25H44FN3O7/c1-18(2)11-15-33-24(3,4)22-21(32-5)19(10-12-25(22)17-34-25)35-23(31)28-14-9-7-6-8-13-27-20(30)16-29-36-26/h11,19,21-22,29H,6-10,12-17H2,1-5H3,(H,27,30)(H,28,31)/t19?,21?,22?,25-/m0/s1 |
| InChIKey | BVFSNUBXEMIAPR-JNEKPGMPSA-N |
| XLogP | 3.12 |
| TPSA | 119.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|