C26H38N2O5 — CID 146543952
[(3R,4R,5S,6R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-(pyridin-2-ylmethyl)azetidine-1-carboxylate (PubChem CID 146543952) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-(pyridin-2-ylmethyl)azetidine-1-carboxylate.
| Compound Name | [(3R,4R,5S,6R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-(pyridin-2-ylmethyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 146543952 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | [(3R,4R,5S,6R)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-(pyridin-2-ylmethyl)azetidine-1-carboxylate |
| SMILES | CO[C@H]1[C@H](C(C)(C)OCC=C(C)C)[C@]2(CC[C@H]1OC(=O)N1CC(Cc3ccccn3)C1)CO2 |
| InChI | InChI=1S/C26H38N2O5/c1-18(2)10-13-31-25(3,4)23-22(30-5)21(9-11-26(23)17-32-26)33-24(29)28-15-19(16-28)14-20-8-6-7-12-27-20/h6-8,10,12,19,21-23H,9,11,13-17H2,1-5H3/t21-,22-,23-,26+/m1/s1 |
| InChIKey | RICYBRNAFBSSTJ-FCBCXNLDSA-N |
| XLogP | 4.02 |
| TPSA | 73.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|