C26H38N2O5 — CID 142827243
[(3R,4S,5S,6R)-4-(2,6-dimethylhept-5-en-2-yl)-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[(1R)-2-amino-2-oxo-1-phenylethyl]carbamate (PubChem CID 142827243) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-4-(2,6-dimethylhept-5-en-2-yl)-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[(1R)-2-amino-2-oxo-1-phenylethyl]carbamate.
| Compound Name | [(3R,4S,5S,6R)-4-(2,6-dimethylhept-5-en-2-yl)-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[(1R)-2-amino-2-oxo-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 142827243 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | [(3R,4S,5S,6R)-4-(2,6-dimethylhept-5-en-2-yl)-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[(1R)-2-amino-2-oxo-1-phenylethyl]carbamate |
| SMILES | CO[C@H]1[C@H](C(C)(C)CCC=C(C)C)[C@]2(CC[C@H]1OC(=O)N[C@@H](C(N)=O)c1ccccc1)CO2 |
| InChI | InChI=1S/C26H38N2O5/c1-17(2)10-9-14-25(3,4)22-21(31-5)19(13-15-26(22)16-32-26)33-24(30)28-20(23(27)29)18-11-7-6-8-12-18/h6-8,10-12,19-22H,9,13-16H2,1-5H3,(H2,27,29)(H,28,30)/t19-,20-,21-,22-,26+/m1/s1 |
| InChIKey | MXEYHVDNGAUQTG-OLROQXJNSA-N |
| XLogP | 4.27 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|