C28H45NO6 — CID 142827242
methyl (2R)-2-cyclohexyl-2-[[(3R,4S,5S,6R)-5-methoxy-4-[(1S,2R)-1-methyl-2-(3-methylbut-2-enyl)cyclobutyl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]acetate (PubChem CID 142827242) has the molecular formula C28H45NO6 and a molecular weight of 491.67 g/mol. Its IUPAC name is methyl (2R)-2-cyclohexyl-2-[[(3R,4S,5S,6R)-5-methoxy-4-[(1S,2R)-1-methyl-2-(3-methylbut-2-enyl)cyclobutyl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]acetate.
| Compound Name | methyl (2R)-2-cyclohexyl-2-[[(3R,4S,5S,6R)-5-methoxy-4-[(1S,2R)-1-methyl-2-(3-methylbut-2-enyl)cyclobutyl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 142827242 |
| Molecular Formula | C28H45NO6 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.32 |
| IUPAC Name | methyl (2R)-2-cyclohexyl-2-[[(3R,4S,5S,6R)-5-methoxy-4-[(1S,2R)-1-methyl-2-(3-methylbut-2-enyl)cyclobutyl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]acetate |
| SMILES | COC(=O)[C@H](NC(=O)O[C@@H]1CC[C@]2(CO2)[C@@H]([C@@]2(C)CC[C@@H]2CC=C(C)C)[C@@H]1OC)C1CCCCC1 |
| InChI | InChI=1S/C28H45NO6/c1-18(2)11-12-20-13-15-27(20,3)24-23(32-4)21(14-16-28(24)17-34-28)35-26(31)29-22(25(30)33-5)19-9-7-6-8-10-19/h11,19-24H,6-10,12-17H2,1-5H3,(H,29,31)/t20-,21+,22+,23+,24+,27-,28-/m0/s1 |
| InChIKey | LCAFQHCLKQZMAF-JNGDMFNZSA-N |
| XLogP | 5.17 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|