C31H52N4O8 — CID 123890972
[2-[[5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-6-en-6-yl]oxycarbonylamino]-3-methylbutyl] N-[6-[(2-aminoacetyl)amino]hexyl]carbamate (PubChem CID 123890972) has the molecular formula C31H52N4O8 and a molecular weight of 608.78 g/mol. Its IUPAC name is [2-[[5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-6-en-6-yl]oxycarbonylamino]-3-methylbutyl] N-[6-[(2-aminoacetyl)amino]hexyl]carbamate.
| Compound Name | [2-[[5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-6-en-6-yl]oxycarbonylamino]-3-methylbutyl] N-[6-[(2-aminoacetyl)amino]hexyl]carbamate |
|---|---|
| PubChem CID | 123890972 |
| Molecular Formula | C31H52N4O8 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.38 |
| IUPAC Name | [2-[[5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-6-en-6-yl]oxycarbonylamino]-3-methylbutyl] N-[6-[(2-aminoacetyl)amino]hexyl]carbamate |
| SMILES | COC1C(OC(=O)NC(COC(=O)NCCCCCCNC(=O)CN)C(C)C)=CCC2(CO2)C1C1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C31H52N4O8/c1-20(2)11-12-24-30(5,43-24)27-26(39-6)23(13-14-31(27)19-41-31)42-29(38)35-22(21(3)4)18-40-28(37)34-16-10-8-7-9-15-33-25(36)17-32/h11,13,21-22,24,26-27H,7-10,12,14-19,32H2,1-6H3,(H,33,36)(H,34,37)(H,35,38) |
| InChIKey | WEURBXXFZFWRDT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 166.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|