C29H42O5 — CID 162935976
[(3S)-5-[(1S,4aS,7S,8aS)-7-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 162935976) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is [(3S)-5-[(1S,4aS,7S,8aS)-7-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(3S)-5-[(1S,4aS,7S,8aS)-7-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162935976 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | [(3S)-5-[(1S,4aS,7S,8aS)-7-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CC1=CC[C@H]2C(C)(C)C[C@H](O)C[C@]2(C)[C@H]1CC[C@H](C)CCOC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C29H42O5/c1-19(14-15-34-27(33)13-9-21-8-11-24(31)25(32)16-21)6-10-23-20(2)7-12-26-28(3,4)17-22(30)18-29(23,26)5/h7-9,11,13,16,19,22-23,26,30-32H,6,10,12,14-15,17-18H2,1-5H3/t19-,22-,23-,26-,29+/m0/s1 |
| InChIKey | KFJOEAITVTUVHW-ZFMRRVDSSA-N |
| XLogP | 6.23 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|